C56H80B2 — CID 173170916
CID 173170916 (PubChem CID 173170916) has the molecular formula C56H80B2 and a molecular weight of 774.88 g/mol.
| Compound Name | CID 173170916 |
|---|---|
| PubChem CID | 173170916 |
| Molecular Formula | C56H80B2 |
| Molecular Weight | 774.88 g/mol |
| Exact Mass | 774.64 |
| IUPAC Name | — |
| SMILES | [B]C(c1ccccc1C([B])(C12CC3CC(C)(CC(C)(C3)C1)C2)C12CC3CC(C)(CC(C)(C3)C1)C2)(C12CC3CC(C)(CC(C)(C3)C1)C2)C12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C56H80B2/c1-43-13-37-14-44(2,25-43)30-51(21-37,29-43)55(57,52-22-38-15-45(3,31-52)26-46(4,16-38)32-52)41-11-9-10-12-42(41)56(58,53-23-39-17-47(5,33-53)27-48(6,18-39)34-53)54-24-40-19-49(7,35-54)28-50(8,20-40)36-54/h9-12,37-40H,13-36H2,1-8H3 |
| InChIKey | QDDQALSKTMCOHR-UHFFFAOYSA-N |
| XLogP | 14.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.88 |
| LogP ≤ 5 | 14.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|