About 1,4-benzoxazepin-4-ium
1,4-benzoxazepin-4-ium (PubChem CID 173184889) has the molecular formula C9H8NO+
and a molecular weight of 146.17 g/mol. Its IUPAC name is 1,4-benzoxazepin-4-ium.
Molecular Properties
| Compound Name | 1,4-benzoxazepin-4-ium |
| PubChem CID | 173184889 |
| Molecular Formula | C9H8NO+ |
| Molecular Weight | 146.17 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 1,4-benzoxazepin-4-ium |
| SMILES | C1=COc2ccccc2C=[NH+]1 |
| InChI | InChI=1S/C9H7NO/c1-2-4-9-8(3-1)7-10-5-6-11-9/h1-7H/p+1 |
| InChIKey | UWXIKAZQXAYFPT-UHFFFAOYSA-O |
| XLogP | 0.05 |
| TPSA | 23.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.17 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,4-benzoxazepin-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-benzoxazepin-4-ium?
The IUPAC name of 1,4-benzoxazepin-4-ium (CID 173184889) is 1,4-benzoxazepin-4-ium.
What is the SMILES notation for 1,4-benzoxazepin-4-ium?
The canonical SMILES for 1,4-benzoxazepin-4-ium is C1=COc2ccccc2C=[NH+]1.
What is the InChIKey of 1,4-benzoxazepin-4-ium?
The InChIKey is UWXIKAZQXAYFPT-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H7NO/c1-2-4-9-8(3-1)7-10-5-6-11-9/h1-7H/p+1.
What are the key properties of 1,4-benzoxazepin-4-ium?
1,4-benzoxazepin-4-ium has a molecular weight of 146.17 g/mol, XLogP of 0.05, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-benzoxazepin-4-ium is sourced from PubChem (CID 173184889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).