C6H13AsO5 — CID 173185656
(2R,3S,5S)-3-arsanyloxy-2,5,6-trihydroxyhexanal (PubChem CID 173185656) has the molecular formula C6H13AsO5 and a molecular weight of 240.09 g/mol. Its IUPAC name is (2R,3S,5S)-3-arsanyloxy-2,5,6-trihydroxyhexanal.
| Compound Name | (2R,3S,5S)-3-arsanyloxy-2,5,6-trihydroxyhexanal |
|---|---|
| PubChem CID | 173185656 |
| Molecular Formula | C6H13AsO5 |
| Molecular Weight | 240.09 g/mol |
| Exact Mass | 240.00 |
| IUPAC Name | (2R,3S,5S)-3-arsanyloxy-2,5,6-trihydroxyhexanal |
| SMILES | O=C[C@H](O)[C@H](C[C@H](O)CO)O[AsH2] |
| InChI | InChI=1S/C6H13AsO5/c7-12-6(5(11)3-9)1-4(10)2-8/h3-6,8,10-11H,1-2,7H2/t4-,5-,6-/m0/s1 |
| InChIKey | TUANINHVFWBMRS-ZLUOBGJFSA-N |
| XLogP | -2.78 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.09 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|