C9H18O4 — CID 157459345
2,4-dihydroxy-3-(3-methylbutan-2-yloxy)butanal (PubChem CID 157459345) has the molecular formula C9H18O4 and a molecular weight of 190.24 g/mol. Its IUPAC name is 2,4-dihydroxy-3-(3-methylbutan-2-yloxy)butanal.
| Compound Name | 2,4-dihydroxy-3-(3-methylbutan-2-yloxy)butanal |
|---|---|
| PubChem CID | 157459345 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 2,4-dihydroxy-3-(3-methylbutan-2-yloxy)butanal |
| SMILES | CC(C)C(C)OC(CO)C(O)C=O |
| InChI | InChI=1S/C9H18O4/c1-6(2)7(3)13-9(5-11)8(12)4-10/h4,6-9,11-12H,5H2,1-3H3 |
| InChIKey | QMWIILNWGBXKJB-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|