C13H24O7 — CID 57136734
2-[(1R,2S,3S,5R)-2-(dimethoxymethyl)-3,5-dihydroxycyclopentyl]-4,5-dihydroxypentanal (PubChem CID 57136734) has the molecular formula C13H24O7 and a molecular weight of 292.33 g/mol. Its IUPAC name is 2-[(1R,2S,3S,5R)-2-(dimethoxymethyl)-3,5-dihydroxycyclopentyl]-4,5-dihydroxypentanal.
| Compound Name | 2-[(1R,2S,3S,5R)-2-(dimethoxymethyl)-3,5-dihydroxycyclopentyl]-4,5-dihydroxypentanal |
|---|---|
| PubChem CID | 57136734 |
| Molecular Formula | C13H24O7 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 2-[(1R,2S,3S,5R)-2-(dimethoxymethyl)-3,5-dihydroxycyclopentyl]-4,5-dihydroxypentanal |
| SMILES | COC(OC)[C@H]1[C@@H](C(C=O)CC(O)CO)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C13H24O7/c1-19-13(20-2)12-10(18)4-9(17)11(12)7(5-14)3-8(16)6-15/h5,7-13,15-18H,3-4,6H2,1-2H3/t7?,8?,9-,10+,11+,12-/m1/s1 |
| InChIKey | RKFQQENZSRGHCK-MCPGOIETSA-N |
| XLogP | -1.48 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|