C27H29N3O6S — CID 173250673
methyl 4-amino-5-[3-(dimethylamino)-3-oxoprop-1-enyl]-2-(4-methoxyphenyl)sulfonyl-3-methyl-6-(pyridin-3-ylmethyl)benzoate (PubChem CID 173250673) has the molecular formula C27H29N3O6S and a molecular weight of 523.61 g/mol. Its IUPAC name is methyl 4-amino-5-[3-(dimethylamino)-3-oxoprop-1-enyl]-2-(4-methoxyphenyl)sulfonyl-3-methyl-6-(pyridin-3-ylmethyl)benzoate.
| Compound Name | methyl 4-amino-5-[3-(dimethylamino)-3-oxoprop-1-enyl]-2-(4-methoxyphenyl)sulfonyl-3-methyl-6-(pyridin-3-ylmethyl)benzoate |
|---|---|
| PubChem CID | 173250673 |
| Molecular Formula | C27H29N3O6S |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | methyl 4-amino-5-[3-(dimethylamino)-3-oxoprop-1-enyl]-2-(4-methoxyphenyl)sulfonyl-3-methyl-6-(pyridin-3-ylmethyl)benzoate |
| SMILES | COC(=O)c1c(Cc2cccnc2)c(C=CC(=O)N(C)C)c(N)c(C)c1S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C27H29N3O6S/c1-17-25(28)21(12-13-23(31)30(2)3)22(15-18-7-6-14-29-16-18)24(27(32)36-5)26(17)37(33,34)20-10-8-19(35-4)9-11-20/h6-14,16H,15,28H2,1-5H3 |
| InChIKey | UJILRRFGACCHGC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 128.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|