C10H19N3O7 — CID 173279567
2-imino-1-methylimidazolidin-4-one;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal (PubChem CID 173279567) has the molecular formula C10H19N3O7 and a molecular weight of 293.28 g/mol. Its IUPAC name is 2-imino-1-methylimidazolidin-4-one;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | 2-imino-1-methylimidazolidin-4-one;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 173279567 |
| Molecular Formula | C10H19N3O7 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 2-imino-1-methylimidazolidin-4-one;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
| SMILES | O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[H]/N=C1/NC(=O)CN1C |
| InChI | InChI=1S/C6H12O6.C4H7N3O/c7-1-3(9)5(11)6(12)4(10)2-8;1-7-2-3(8)6-4(7)5/h1,3-6,8-12H,2H2;2H2,1H3,(H2,5,6,8)/t3-,4+,5+,6+;/m0./s1 |
| InChIKey | INVFZHFGYBJOBL-BTVCFUMJSA-N |
| XLogP | -4.40 |
| TPSA | 174.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | -4.40 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|