C8H18N2O6 — CID 159566657
ethanimidamide;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal (PubChem CID 159566657) has the molecular formula C8H18N2O6 and a molecular weight of 238.24 g/mol. Its IUPAC name is ethanimidamide;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | ethanimidamide;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 159566657 |
| Molecular Formula | C8H18N2O6 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | ethanimidamide;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
| SMILES | O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[H]/N=C(\C)N |
| InChI | InChI=1S/C6H12O6.C2H6N2/c7-1-3(9)5(11)6(12)4(10)2-8;1-2(3)4/h1,3-6,8-12H,2H2;1H3,(H3,3,4)/t3-,4+,5+,6+;/m0./s1 |
| InChIKey | MHGZHSLJCZAXAA-BTVCFUMJSA-N |
| XLogP | -3.44 |
| TPSA | 168.09 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|