C11H24N2O8S2 — CID 173332854
[4-(sulfomethyl)pyrrolidin-3-yl]methanesulfonic acid;2-(trimethylazaniumyl)acetate (PubChem CID 173332854) has the molecular formula C11H24N2O8S2 and a molecular weight of 376.45 g/mol. Its IUPAC name is [4-(sulfomethyl)pyrrolidin-3-yl]methanesulfonic acid;2-(trimethylazaniumyl)acetate.
| Compound Name | [4-(sulfomethyl)pyrrolidin-3-yl]methanesulfonic acid;2-(trimethylazaniumyl)acetate |
|---|---|
| PubChem CID | 173332854 |
| Molecular Formula | C11H24N2O8S2 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | [4-(sulfomethyl)pyrrolidin-3-yl]methanesulfonic acid;2-(trimethylazaniumyl)acetate |
| SMILES | C[N+](C)(C)CC(=O)[O-].O=S(=O)(O)CC1CNCC1CS(=O)(=O)O |
| InChI | InChI=1S/C6H13NO6S2.C5H11NO2/c8-14(9,10)3-5-1-7-2-6(5)4-15(11,12)13;1-6(2,3)4-5(7)8/h5-7H,1-4H2,(H,8,9,10)(H,11,12,13);4H2,1-3H3 |
| InChIKey | KOUMCFWUUBNQRP-UHFFFAOYSA-N |
| XLogP | -2.96 |
| TPSA | 160.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|