C24H20ClN3O6S — CID 173359253
benzhydryl 2-[[1-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxy-2-oxoethylidene]amino]oxyprop-2-enoate (PubChem CID 173359253) has the molecular formula C24H20ClN3O6S and a molecular weight of 513.96 g/mol. Its IUPAC name is benzhydryl 2-[[1-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxy-2-oxoethylidene]amino]oxyprop-2-enoate.
| Compound Name | benzhydryl 2-[[1-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxy-2-oxoethylidene]amino]oxyprop-2-enoate |
|---|---|
| PubChem CID | 173359253 |
| Molecular Formula | C24H20ClN3O6S |
| Molecular Weight | 513.96 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | benzhydryl 2-[[1-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxy-2-oxoethylidene]amino]oxyprop-2-enoate |
| SMILES | C=C(ON=C(C(=O)OC)c1csc(NC(=O)CCl)n1)C(=O)OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H20ClN3O6S/c1-15(22(30)33-21(16-9-5-3-6-10-16)17-11-7-4-8-12-17)34-28-20(23(31)32-2)18-14-35-24(26-18)27-19(29)13-25/h3-12,14,21H,1,13H2,2H3,(H,26,27,29) |
| InChIKey | ONPQHIUGFSOXJI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 116.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.96 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|