C21H39NO5Si — CID 173364540
tert-butyl (2R,4R)-4-tert-butyl-2-(4-ethoxy-4-oxobut-2-enyl)-3,3-dimethyl-2-silyloxypyrrolidine-1-carboxylate (PubChem CID 173364540) has the molecular formula C21H39NO5Si and a molecular weight of 413.63 g/mol. Its IUPAC name is tert-butyl (2R,4R)-4-tert-butyl-2-(4-ethoxy-4-oxobut-2-enyl)-3,3-dimethyl-2-silyloxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4R)-4-tert-butyl-2-(4-ethoxy-4-oxobut-2-enyl)-3,3-dimethyl-2-silyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 173364540 |
| Molecular Formula | C21H39NO5Si |
| Molecular Weight | 413.63 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | tert-butyl (2R,4R)-4-tert-butyl-2-(4-ethoxy-4-oxobut-2-enyl)-3,3-dimethyl-2-silyloxypyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)C=CC[C@]1(O[SiH3])N(C(=O)OC(C)(C)C)C[C@H](C(C)(C)C)C1(C)C |
| InChI | InChI=1S/C21H39NO5Si/c1-10-25-16(23)12-11-13-21(27-28)20(8,9)15(18(2,3)4)14-22(21)17(24)26-19(5,6)7/h11-12,15H,10,13-14H2,1-9,28H3/t15-,21-/m1/s1 |
| InChIKey | UYLMXURTEKEGRC-QVKFZJNVSA-N |
| XLogP | 3.43 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.63 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|