C27H33NO5 — CID 173388962
methyl 7-[(2R,4R,5S)-4-(benzhydryloxyiminomethyl)-2-methyl-1,3-dioxan-5-yl]hept-5-enoate (PubChem CID 173388962) has the molecular formula C27H33NO5 and a molecular weight of 451.56 g/mol. Its IUPAC name is methyl 7-[(2R,4R,5S)-4-(benzhydryloxyiminomethyl)-2-methyl-1,3-dioxan-5-yl]hept-5-enoate.
| Compound Name | methyl 7-[(2R,4R,5S)-4-(benzhydryloxyiminomethyl)-2-methyl-1,3-dioxan-5-yl]hept-5-enoate |
|---|---|
| PubChem CID | 173388962 |
| Molecular Formula | C27H33NO5 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | methyl 7-[(2R,4R,5S)-4-(benzhydryloxyiminomethyl)-2-methyl-1,3-dioxan-5-yl]hept-5-enoate |
| SMILES | COC(=O)CCCC=CC[C@H]1CO[C@@H](C)O[C@H]1C=NOC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H33NO5/c1-21-31-20-24(17-7-3-4-12-18-26(29)30-2)25(32-21)19-28-33-27(22-13-8-5-9-14-22)23-15-10-6-11-16-23/h3,5-11,13-16,19,21,24-25,27H,4,12,17-18,20H2,1-2H3/t21-,24+,25+/m1/s1 |
| InChIKey | IOSNIQHDYADXPY-ZODMCCGTSA-N |
| XLogP | 5.45 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|