C26H31NO5 — CID 173389011
7-[(2R,4R,5S)-4-(benzhydryloxyiminomethyl)-2-methyl-1,3-dioxan-5-yl]hept-5-enoic acid (PubChem CID 173389011) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is 7-[(2R,4R,5S)-4-(benzhydryloxyiminomethyl)-2-methyl-1,3-dioxan-5-yl]hept-5-enoic acid.
| Compound Name | 7-[(2R,4R,5S)-4-(benzhydryloxyiminomethyl)-2-methyl-1,3-dioxan-5-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 173389011 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 7-[(2R,4R,5S)-4-(benzhydryloxyiminomethyl)-2-methyl-1,3-dioxan-5-yl]hept-5-enoic acid |
| SMILES | C[C@@H]1OC[C@H](CC=CCCCC(=O)O)[C@H](C=NOC(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C26H31NO5/c1-20-30-19-23(16-6-2-3-11-17-25(28)29)24(31-20)18-27-32-26(21-12-7-4-8-13-21)22-14-9-5-10-15-22/h2,4-10,12-15,18,20,23-24,26H,3,11,16-17,19H2,1H3,(H,28,29)/t20-,23+,24+/m1/s1 |
| InChIKey | SYKJHZNZDHVXCE-QDSKXPNFSA-N |
| XLogP | 5.36 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|