C16H18O4S2 — CID 173451557
1,2-bis(3-ethenylsulfonylprop-2-enyl)benzene (PubChem CID 173451557) has the molecular formula C16H18O4S2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 1,2-bis(3-ethenylsulfonylprop-2-enyl)benzene.
| Compound Name | 1,2-bis(3-ethenylsulfonylprop-2-enyl)benzene |
|---|---|
| PubChem CID | 173451557 |
| Molecular Formula | C16H18O4S2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 1,2-bis(3-ethenylsulfonylprop-2-enyl)benzene |
| SMILES | C=CS(=O)(=O)C=CCc1ccccc1CC=CS(=O)(=O)C=C |
| InChI | InChI=1S/C16H18O4S2/c1-3-21(17,18)13-7-11-15-9-5-6-10-16(15)12-8-14-22(19,20)4-2/h3-10,13-14H,1-2,11-12H2 |
| InChIKey | BMMANBSGJSVESQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |