C12H13ClN4O2 — CID 173478321
3-[5-(3-chloropropyl)-1,2,4-oxadiazol-3-yl]-N'-hydroxybenzenecarboximidamide (PubChem CID 173478321) has the molecular formula C12H13ClN4O2 and a molecular weight of 280.72 g/mol. Its IUPAC name is 3-[5-(3-chloropropyl)-1,2,4-oxadiazol-3-yl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 3-[5-(3-chloropropyl)-1,2,4-oxadiazol-3-yl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 173478321 |
| Molecular Formula | C12H13ClN4O2 |
| Molecular Weight | 280.72 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 3-[5-(3-chloropropyl)-1,2,4-oxadiazol-3-yl]-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N\O)c1cccc(-c2noc(CCCCl)n2)c1 |
| InChI | InChI=1S/C12H13ClN4O2/c13-6-2-5-10-15-12(17-19-10)9-4-1-3-8(7-9)11(14)16-18/h1,3-4,7,18H,2,5-6H2,(H2,14,16) |
| InChIKey | UBNIKFHZKNUOBQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 97.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.72 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|