C22H19ClN4O5S2 — CID 17375092
4-(3-chloro-6-nitro-1-benzothiophene-2-carbonyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazine-1-carbothioamide (PubChem CID 17375092) has the molecular formula C22H19ClN4O5S2 and a molecular weight of 519.00 g/mol. Its IUPAC name is 4-(3-chloro-6-nitro-1-benzothiophene-2-carbonyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazine-1-carbothioamide.
| Compound Name | 4-(3-chloro-6-nitro-1-benzothiophene-2-carbonyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 17375092 |
| Molecular Formula | C22H19ClN4O5S2 |
| Molecular Weight | 519.00 g/mol |
| Exact Mass | 518.05 |
| IUPAC Name | 4-(3-chloro-6-nitro-1-benzothiophene-2-carbonyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazine-1-carbothioamide |
| SMILES | O=C(c1sc2cc([N+](=O)[O-])ccc2c1Cl)N1CCN(C(=S)Nc2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C22H19ClN4O5S2/c23-19-15-3-2-14(27(29)30)12-18(15)34-20(19)21(28)25-5-7-26(8-6-25)22(33)24-13-1-4-16-17(11-13)32-10-9-31-16/h1-4,11-12H,5-10H2,(H,24,33) |
| InChIKey | MICFJSFFXXVIJP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.00 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|