C21H32N5O15P3S — CID 174034353
[[(4R)-4-(6-aminopurin-9-yl)-4-methoxy-2-[(2,4,6-trimethoxyphenyl)methylsulfanylmethoxy]butoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 174034353) has the molecular formula C21H32N5O15P3S and a molecular weight of 719.50 g/mol. Its IUPAC name is [[(4R)-4-(6-aminopurin-9-yl)-4-methoxy-2-[(2,4,6-trimethoxyphenyl)methylsulfanylmethoxy]butoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(4R)-4-(6-aminopurin-9-yl)-4-methoxy-2-[(2,4,6-trimethoxyphenyl)methylsulfanylmethoxy]butoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 174034353 |
| Molecular Formula | C21H32N5O15P3S |
| Molecular Weight | 719.50 g/mol |
| Exact Mass | 719.08 |
| IUPAC Name | [[(4R)-4-(6-aminopurin-9-yl)-4-methoxy-2-[(2,4,6-trimethoxyphenyl)methylsulfanylmethoxy]butoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | COc1cc(OC)c(CSCOC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C[C@@H](OC)n2cnc3c(N)ncnc32)c(OC)c1 |
| InChI | InChI=1S/C21H32N5O15P3S/c1-34-13-5-16(35-2)15(17(6-13)36-3)9-45-12-38-14(8-39-43(30,31)41-44(32,33)40-42(27,28)29)7-18(37-4)26-11-25-19-20(22)23-10-24-21(19)26/h5-6,10-11,14,18H,7-9,12H2,1-4H3,(H,30,31)(H,32,33)(H2,22,23,24)(H2,27,28,29)/t14?,18-/m1/s1 |
| InChIKey | XAYIMZPZCAHVBP-XPKAQORNSA-N |
| XLogP | 2.59 |
| TPSA | 275.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.50 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|