C18H28BO9PS — CID 174046454
CID 174046454 (PubChem CID 174046454) has the molecular formula C18H28BO9PS and a molecular weight of 462.27 g/mol.
| Compound Name | CID 174046454 |
|---|---|
| PubChem CID | 174046454 |
| Molecular Formula | C18H28BO9PS |
| Molecular Weight | 462.27 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@H](COC)C(OP(C)(=O)O)C1OCSCc1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C18H28BO9PS/c1-22-8-15-16(28-29(5,20)21)17(18(19)27-15)26-10-30-9-12-13(24-3)6-11(23-2)7-14(12)25-4/h6-7,15-18H,8-10H2,1-5H3,(H,20,21)/t15-,16?,17?,18-/m1/s1 |
| InChIKey | VVYDYYSAUWLTAZ-AQEOSJORSA-N |
| XLogP | 2.03 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|