C21H40OSi — CID 174060822
(1R,3aR,7aR)-7a-methyl-1-(2-methyl-2-silyldecan-3-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 174060822) has the molecular formula C21H40OSi and a molecular weight of 336.64 g/mol. Its IUPAC name is (1R,3aR,7aR)-7a-methyl-1-(2-methyl-2-silyldecan-3-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (1R,3aR,7aR)-7a-methyl-1-(2-methyl-2-silyldecan-3-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 174060822 |
| Molecular Formula | C21H40OSi |
| Molecular Weight | 336.64 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | (1R,3aR,7aR)-7a-methyl-1-(2-methyl-2-silyldecan-3-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | CCCCCCCC([C@H]1CC[C@H]2C(=O)CCC[C@]12C)C(C)(C)[SiH3] |
| InChI | InChI=1S/C21H40OSi/c1-5-6-7-8-9-11-16(20(2,3)23)17-13-14-18-19(22)12-10-15-21(17,18)4/h16-18H,5-15H2,1-4,23H3/t16?,17-,18+,21-/m1/s1 |
| InChIKey | QBZVMZOMSMISTJ-GKTUAVMOSA-N |
| XLogP | 5.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.64 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|