C10H22N4 — CID 174149128
2-(dimethylamino)-N'-[[(E)-2,3-dimethylbut-1-enyl]amino]ethanimidamide (PubChem CID 174149128) has the molecular formula C10H22N4 and a molecular weight of 198.31 g/mol. Its IUPAC name is 2-(dimethylamino)-N'-[[(E)-2,3-dimethylbut-1-enyl]amino]ethanimidamide.
| Compound Name | 2-(dimethylamino)-N'-[[(E)-2,3-dimethylbut-1-enyl]amino]ethanimidamide |
|---|---|
| PubChem CID | 174149128 |
| Molecular Formula | C10H22N4 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | 2-(dimethylamino)-N'-[[(E)-2,3-dimethylbut-1-enyl]amino]ethanimidamide |
| SMILES | C/C(=C\N/N=C(\N)CN(C)C)C(C)C |
| InChI | InChI=1S/C10H22N4/c1-8(2)9(3)6-12-13-10(11)7-14(4)5/h6,8,12H,7H2,1-5H3,(H2,11,13)/b9-6+ |
| InChIKey | ATQBCPADISFNDD-RMKNXTFCSA-N |
| XLogP | 0.97 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|