C24H41BN2O6Si — CID 174172915
[5-[3-[2-[tert-butyl(dimethyl)silyl]oxypropoxy]propoxy]-1-(oxan-2-yl)indazol-3-yl]boronic acid (PubChem CID 174172915) has the molecular formula C24H41BN2O6Si and a molecular weight of 492.50 g/mol. Its IUPAC name is [5-[3-[2-[tert-butyl(dimethyl)silyl]oxypropoxy]propoxy]-1-(oxan-2-yl)indazol-3-yl]boronic acid.
| Compound Name | [5-[3-[2-[tert-butyl(dimethyl)silyl]oxypropoxy]propoxy]-1-(oxan-2-yl)indazol-3-yl]boronic acid |
|---|---|
| PubChem CID | 174172915 |
| Molecular Formula | C24H41BN2O6Si |
| Molecular Weight | 492.50 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | [5-[3-[2-[tert-butyl(dimethyl)silyl]oxypropoxy]propoxy]-1-(oxan-2-yl)indazol-3-yl]boronic acid |
| SMILES | CC(COCCCOc1ccc2c(c1)c(B(O)O)nn2C1CCCCO1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H41BN2O6Si/c1-18(33-34(5,6)24(2,3)4)17-30-13-9-15-31-19-11-12-21-20(16-19)23(25(28)29)26-27(21)22-10-7-8-14-32-22/h11-12,16,18,22,28-29H,7-10,13-15,17H2,1-6H3 |
| InChIKey | APFKXYIQXIDFSZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|