C24H27BN2O3 — CID 174225484
1-phenyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2H-pyridine-3-carboxamide (PubChem CID 174225484) has the molecular formula C24H27BN2O3 and a molecular weight of 402.30 g/mol. Its IUPAC name is 1-phenyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2H-pyridine-3-carboxamide.
| Compound Name | 1-phenyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 174225484 |
| Molecular Formula | C24H27BN2O3 |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 1-phenyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2H-pyridine-3-carboxamide |
| SMILES | CC1(C)OB(c2ccc(NC(=O)C3=CC=CN(c4ccccc4)C3)cc2)OC1(C)C |
| InChI | InChI=1S/C24H27BN2O3/c1-23(2)24(3,4)30-25(29-23)19-12-14-20(15-13-19)26-22(28)18-9-8-16-27(17-18)21-10-6-5-7-11-21/h5-16H,17H2,1-4H3,(H,26,28) |
| InChIKey | ICTYGZWKGYKUCP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|