About 4,4-diphenylbut-3-en-2-one;palladium
4,4-diphenylbut-3-en-2-one;palladium (PubChem CID 174269775) has the molecular formula C16H13OPd-
and a molecular weight of 327.70 g/mol. Its IUPAC name is 4,4-diphenylbut-3-en-2-one;palladium.
Molecular Properties
| Compound Name | 4,4-diphenylbut-3-en-2-one;palladium |
| PubChem CID | 174269775 |
| Molecular Formula | C16H13OPd- |
| Molecular Weight | 327.70 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | 4,4-diphenylbut-3-en-2-one;palladium |
| SMILES | CC(=O)[C-]=C(c1ccccc1)c1ccccc1.[Pd] |
| InChI | InChI=1S/C16H13O.Pd/c1-13(17)12-16(14-8-4-2-5-9-14)15-10-6-3-7-11-15;/h2-11H,1H3;/q-1; |
| InChIKey | LEYVJSIIXDZIRB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.70 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4,4-diphenylbut-3-en-2-one;palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-diphenylbut-3-en-2-one;palladium?
The IUPAC name of 4,4-diphenylbut-3-en-2-one;palladium (CID 174269775) is 4,4-diphenylbut-3-en-2-one;palladium.
What is the SMILES notation for 4,4-diphenylbut-3-en-2-one;palladium?
The canonical SMILES for 4,4-diphenylbut-3-en-2-one;palladium is CC(=O)[C-]=C(c1ccccc1)c1ccccc1.[Pd].
What is the InChIKey of 4,4-diphenylbut-3-en-2-one;palladium?
The InChIKey is LEYVJSIIXDZIRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13O.Pd/c1-13(17)12-16(14-8-4-2-5-9-14)15-10-6-3-7-11-15;/h2-11H,1H3;/q-1;.
What are the key properties of 4,4-diphenylbut-3-en-2-one;palladium?
4,4-diphenylbut-3-en-2-one;palladium has a molecular weight of 327.70 g/mol, XLogP of 3.51, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-diphenylbut-3-en-2-one;palladium is sourced from PubChem (CID 174269775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).