C11H14O4 — CID 174283653
benzene-1,3-diol;2-methylbut-2-enoic acid (PubChem CID 174283653) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is benzene-1,3-diol;2-methylbut-2-enoic acid.
| Compound Name | benzene-1,3-diol;2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 174283653 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | benzene-1,3-diol;2-methylbut-2-enoic acid |
| SMILES | CC=C(C)C(=O)O.Oc1cccc(O)c1 |
| InChI | InChI=1S/C6H6O2.C5H8O2/c7-5-2-1-3-6(8)4-5;1-3-4(2)5(6)7/h1-4,7-8H;3H,1-2H3,(H,6,7) |
| InChIKey | BSPHLBDREYQNHE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|