C18H26N2 — CID 174369556
2-[6-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-propan-2-yl-2-pyridinyl]-N-methylprop-2-en-1-amine (PubChem CID 174369556) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 2-[6-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-propan-2-yl-2-pyridinyl]-N-methylprop-2-en-1-amine.
| Compound Name | 2-[6-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-propan-2-yl-2-pyridinyl]-N-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 174369556 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 2-[6-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-propan-2-yl-2-pyridinyl]-N-methylprop-2-en-1-amine |
| SMILES | C=C(CNC)c1cc(C(C)C)cc(/C(C)=C/C=C\C)n1 |
| InChI | InChI=1S/C18H26N2/c1-7-8-9-14(4)17-10-16(13(2)3)11-18(20-17)15(5)12-19-6/h7-11,13,19H,5,12H2,1-4,6H3/b8-7-,14-9+ |
| InChIKey | XUYNGWDSRFXUIB-JEHBAHQJSA-N |
| XLogP | 4.42 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|