C22H19NO4 — CID 174388354
N-acetylacetamide;1,4-dihydrochrysene-2,3-dione (PubChem CID 174388354) has the molecular formula C22H19NO4 and a molecular weight of 361.40 g/mol. Its IUPAC name is N-acetylacetamide;1,4-dihydrochrysene-2,3-dione.
| Compound Name | N-acetylacetamide;1,4-dihydrochrysene-2,3-dione |
|---|---|
| PubChem CID | 174388354 |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | N-acetylacetamide;1,4-dihydrochrysene-2,3-dione |
| SMILES | CC(=O)NC(C)=O.O=C1Cc2ccc3c(ccc4ccccc43)c2CC1=O |
| InChI | InChI=1S/C18H12O2.C4H7NO2/c19-17-9-12-6-8-14-13-4-2-1-3-11(13)5-7-15(14)16(12)10-18(17)20;1-3(6)5-4(2)7/h1-8H,9-10H2;1-2H3,(H,5,6,7) |
| InChIKey | ZYZCHAQNFHRPJG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|