About N-acetylacetamide;1,4-dihydrochrysene-2,3-dione
N-acetylacetamide;1,4-dihydrochrysene-2,3-dione (PubChem CID 174388354) has the molecular formula C22H19NO4
and a molecular weight of 361.40 g/mol. Its IUPAC name is N-acetylacetamide;1,4-dihydrochrysene-2,3-dione.
Molecular Properties
| Compound Name | N-acetylacetamide;1,4-dihydrochrysene-2,3-dione |
| PubChem CID | 174388354 |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | N-acetylacetamide;1,4-dihydrochrysene-2,3-dione |
| SMILES | CC(=O)NC(C)=O.O=C1Cc2ccc3c(ccc4ccccc43)c2CC1=O |
| InChI | InChI=1S/C18H12O2.C4H7NO2/c19-17-9-12-6-8-14-13-4-2-1-3-11(13)5-7-15(14)16(12)10-18(17)20;1-3(6)5-4(2)7/h1-8H,9-10H2;1-2H3,(H,5,6,7) |
| InChIKey | ZYZCHAQNFHRPJG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze N-acetylacetamide;1,4-dihydrochrysene-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-acetylacetamide;1,4-dihydrochrysene-2,3-dione?
The IUPAC name of N-acetylacetamide;1,4-dihydrochrysene-2,3-dione (CID 174388354) is N-acetylacetamide;1,4-dihydrochrysene-2,3-dione.
What is the SMILES notation for N-acetylacetamide;1,4-dihydrochrysene-2,3-dione?
The canonical SMILES for N-acetylacetamide;1,4-dihydrochrysene-2,3-dione is CC(=O)NC(C)=O.O=C1Cc2ccc3c(ccc4ccccc43)c2CC1=O.
What is the InChIKey of N-acetylacetamide;1,4-dihydrochrysene-2,3-dione?
The InChIKey is ZYZCHAQNFHRPJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12O2.C4H7NO2/c19-17-9-12-6-8-14-13-4-2-1-3-11(13)5-7-15(14)16(12)10-18(17)20;1-3(6)5-4(2)7/h1-8H,9-10H2;1-2H3,(H,5,6,7).
What are the key properties of N-acetylacetamide;1,4-dihydrochrysene-2,3-dione?
N-acetylacetamide;1,4-dihydrochrysene-2,3-dione has a molecular weight of 361.40 g/mol, XLogP of 2.90, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-acetylacetamide;1,4-dihydrochrysene-2,3-dione is sourced from PubChem (CID 174388354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).