C13H13NO3S — CID 174392074
2,6-dimethyl-N-methylidene-1,1-dioxo-2H-thiochromene-7-carboxamide (PubChem CID 174392074) has the molecular formula C13H13NO3S and a molecular weight of 263.32 g/mol. Its IUPAC name is 2,6-dimethyl-N-methylidene-1,1-dioxo-2H-thiochromene-7-carboxamide.
| Compound Name | 2,6-dimethyl-N-methylidene-1,1-dioxo-2H-thiochromene-7-carboxamide |
|---|---|
| PubChem CID | 174392074 |
| Molecular Formula | C13H13NO3S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 2,6-dimethyl-N-methylidene-1,1-dioxo-2H-thiochromene-7-carboxamide |
| SMILES | C=NC(=O)c1cc2c(cc1C)C=CC(C)S2(=O)=O |
| InChI | InChI=1S/C13H13NO3S/c1-8-6-10-5-4-9(2)18(16,17)12(10)7-11(8)13(15)14-3/h4-7,9H,3H2,1-2H3 |
| InChIKey | FBFOIWVXOXDCIF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|