C19H30O2 — CID 174398055
cumene;1-hydroperoxy-2,6,6-trimethylbicyclo[3.1.1]heptane (PubChem CID 174398055) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is cumene;1-hydroperoxy-2,6,6-trimethylbicyclo[3.1.1]heptane.
| Compound Name | cumene;1-hydroperoxy-2,6,6-trimethylbicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 174398055 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | cumene;1-hydroperoxy-2,6,6-trimethylbicyclo[3.1.1]heptane |
| SMILES | CC(C)c1ccccc1.CC1CCC2CC1(OO)C2(C)C |
| InChI | InChI=1S/C10H18O2.C9H12/c1-7-4-5-8-6-10(7,12-11)9(8,2)3;1-8(2)9-6-4-3-5-7-9/h7-8,11H,4-6H2,1-3H3;3-8H,1-2H3 |
| InChIKey | MNOGFYPWUUKLAD-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|