About boric acid;4-nitrobenzenediazonium;hydrofluoride
boric acid;4-nitrobenzenediazonium;hydrofluoride (PubChem CID 174435045) has the molecular formula C6H8BFN3O5+
and a molecular weight of 231.96 g/mol. Its IUPAC name is boric acid;4-nitrobenzenediazonium;hydrofluoride.
Molecular Properties
| Compound Name | boric acid;4-nitrobenzenediazonium;hydrofluoride |
| PubChem CID | 174435045 |
| Molecular Formula | C6H8BFN3O5+ |
| Molecular Weight | 231.96 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | boric acid;4-nitrobenzenediazonium;hydrofluoride |
| SMILES | F.N#[N+]c1ccc([N+](=O)[O-])cc1.OB(O)O |
| InChI | InChI=1S/C6H4N3O2.BH3O3.FH/c7-8-5-1-3-6(4-2-5)9(10)11;2-1(3)4;/h1-4H;2-4H;1H/q+1;; |
| InChIKey | JSFKHGLBUAVWLG-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 131.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.96 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze boric acid;4-nitrobenzenediazonium;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;4-nitrobenzenediazonium;hydrofluoride?
The IUPAC name of boric acid;4-nitrobenzenediazonium;hydrofluoride (CID 174435045) is boric acid;4-nitrobenzenediazonium;hydrofluoride.
What is the SMILES notation for boric acid;4-nitrobenzenediazonium;hydrofluoride?
The canonical SMILES for boric acid;4-nitrobenzenediazonium;hydrofluoride is F.N#[N+]c1ccc([N+](=O)[O-])cc1.OB(O)O.
What is the InChIKey of boric acid;4-nitrobenzenediazonium;hydrofluoride?
The InChIKey is JSFKHGLBUAVWLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N3O2.BH3O3.FH/c7-8-5-1-3-6(4-2-5)9(10)11;2-1(3)4;/h1-4H;2-4H;1H/q+1;;.
What are the key properties of boric acid;4-nitrobenzenediazonium;hydrofluoride?
boric acid;4-nitrobenzenediazonium;hydrofluoride has a molecular weight of 231.96 g/mol, XLogP of 0.18, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;4-nitrobenzenediazonium;hydrofluoride is sourced from PubChem (CID 174435045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).