C8H11N3O4S2 — CID 174453845
ethyl N-(sulfanylidenemethylidene)carbamate;1H-pyrimidine-2,4-dione;sulfane (PubChem CID 174453845) has the molecular formula C8H11N3O4S2 and a molecular weight of 277.33 g/mol. Its IUPAC name is ethyl N-(sulfanylidenemethylidene)carbamate;1H-pyrimidine-2,4-dione;sulfane.
| Compound Name | ethyl N-(sulfanylidenemethylidene)carbamate;1H-pyrimidine-2,4-dione;sulfane |
|---|---|
| PubChem CID | 174453845 |
| Molecular Formula | C8H11N3O4S2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | ethyl N-(sulfanylidenemethylidene)carbamate;1H-pyrimidine-2,4-dione;sulfane |
| SMILES | CCOC(=O)N=C=S.O=c1cc[nH]c(=O)[nH]1.S |
| InChI | InChI=1S/C4H4N2O2.C4H5NO2S.H2S/c7-3-1-2-5-4(8)6-3;1-2-7-4(6)5-3-8;/h1-2H,(H2,5,6,7,8);2H2,1H3;1H2 |
| InChIKey | GITKIXFYAQXXOF-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 104.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|