About ethyl N-(sulfanylidenemethylidene)carbamate;1H-pyrimidine-2,4-dione;sulfane
ethyl N-(sulfanylidenemethylidene)carbamate;1H-pyrimidine-2,4-dione;sulfane (PubChem CID 174453845) has the molecular formula C8H11N3O4S2
and a molecular weight of 277.33 g/mol. Its IUPAC name is ethyl N-(sulfanylidenemethylidene)carbamate;1H-pyrimidine-2,4-dione;sulfane.
Molecular Properties
| Compound Name | ethyl N-(sulfanylidenemethylidene)carbamate;1H-pyrimidine-2,4-dione;sulfane |
| PubChem CID | 174453845 |
| Molecular Formula | C8H11N3O4S2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | ethyl N-(sulfanylidenemethylidene)carbamate;1H-pyrimidine-2,4-dione;sulfane |
| SMILES | CCOC(=O)N=C=S.O=c1cc[nH]c(=O)[nH]1.S |
| InChI | InChI=1S/C4H4N2O2.C4H5NO2S.H2S/c7-3-1-2-5-4(8)6-3;1-2-7-4(6)5-3-8;/h1-2H,(H2,5,6,7,8);2H2,1H3;1H2 |
| InChIKey | GITKIXFYAQXXOF-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 104.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-(sulfanylidenemethylidene)carbamate;1H-pyrimidine-2,4-dione;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(sulfanylidenemethylidene)carbamate;1H-pyrimidine-2,4-dione;sulfane?
The IUPAC name of ethyl N-(sulfanylidenemethylidene)carbamate;1H-pyrimidine-2,4-dione;sulfane (CID 174453845) is ethyl N-(sulfanylidenemethylidene)carbamate;1H-pyrimidine-2,4-dione;sulfane.
What is the SMILES notation for ethyl N-(sulfanylidenemethylidene)carbamate;1H-pyrimidine-2,4-dione;sulfane?
The canonical SMILES for ethyl N-(sulfanylidenemethylidene)carbamate;1H-pyrimidine-2,4-dione;sulfane is CCOC(=O)N=C=S.O=c1cc[nH]c(=O)[nH]1.S.
What is the InChIKey of ethyl N-(sulfanylidenemethylidene)carbamate;1H-pyrimidine-2,4-dione;sulfane?
The InChIKey is GITKIXFYAQXXOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2.C4H5NO2S.H2S/c7-3-1-2-5-4(8)6-3;1-2-7-4(6)5-3-8;/h1-2H,(H2,5,6,7,8);2H2,1H3;1H2.
What are the key properties of ethyl N-(sulfanylidenemethylidene)carbamate;1H-pyrimidine-2,4-dione;sulfane?
ethyl N-(sulfanylidenemethylidene)carbamate;1H-pyrimidine-2,4-dione;sulfane has a molecular weight of 277.33 g/mol, XLogP of 0.42, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(sulfanylidenemethylidene)carbamate;1H-pyrimidine-2,4-dione;sulfane is sourced from PubChem (CID 174453845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).