C7H8N2O2 — CID 19366285
prop-1-yne;1H-pyrimidine-2,4-dione (PubChem CID 19366285) has the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. Its IUPAC name is prop-1-yne;1H-pyrimidine-2,4-dione.
| Compound Name | prop-1-yne;1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 19366285 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | prop-1-yne;1H-pyrimidine-2,4-dione |
| SMILES | C#CC.O=c1cc[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C4H4N2O2.C3H4/c7-3-1-2-5-4(8)6-3;1-3-2/h1-2H,(H2,5,6,7,8);1H,2H3 |
| InChIKey | VDHRCXJZJMNRNA-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|