C9H16Cl3N3O3 — CID 155128725
2-chloro-N-(2-chloroethyl)-N-methylethanamine oxide;1H-pyrimidine-2,4-dione;hydrochloride (PubChem CID 155128725) has the molecular formula C9H16Cl3N3O3 and a molecular weight of 320.60 g/mol. Its IUPAC name is 2-chloro-N-(2-chloroethyl)-N-methylethanamine oxide;1H-pyrimidine-2,4-dione;hydrochloride.
| Compound Name | 2-chloro-N-(2-chloroethyl)-N-methylethanamine oxide;1H-pyrimidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 155128725 |
| Molecular Formula | C9H16Cl3N3O3 |
| Molecular Weight | 320.60 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 2-chloro-N-(2-chloroethyl)-N-methylethanamine oxide;1H-pyrimidine-2,4-dione;hydrochloride |
| SMILES | C[N+]([O-])(CCCl)CCCl.Cl.O=c1cc[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C5H11Cl2NO.C4H4N2O2.ClH/c1-8(9,4-2-6)5-3-7;7-3-1-2-5-4(8)6-3;/h2-5H2,1H3;1-2H,(H2,5,6,7,8);1H |
| InChIKey | NQYQJQLUAYCOIN-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 88.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.60 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|