About [(5-carbamoyl-1,3-oxazol-2-yl)amino]methanesulfinate
[(5-carbamoyl-1,3-oxazol-2-yl)amino]methanesulfinate (PubChem CID 174461737) has the molecular formula C5H6N3O4S-
and a molecular weight of 204.19 g/mol. Its IUPAC name is [(5-carbamoyl-1,3-oxazol-2-yl)amino]methanesulfinate.
Molecular Properties
| Compound Name | [(5-carbamoyl-1,3-oxazol-2-yl)amino]methanesulfinate |
| PubChem CID | 174461737 |
| Molecular Formula | C5H6N3O4S- |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | [(5-carbamoyl-1,3-oxazol-2-yl)amino]methanesulfinate |
| SMILES | NC(=O)c1cnc(NCS(=O)[O-])o1 |
| InChI | InChI=1S/C5H7N3O4S/c6-4(9)3-1-7-5(12-3)8-2-13(10)11/h1H,2H2,(H2,6,9)(H,7,8)(H,10,11)/p-1 |
| InChIKey | YPENRQIKFAPTOP-UHFFFAOYSA-M |
| XLogP | -0.98 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze [(5-carbamoyl-1,3-oxazol-2-yl)amino]methanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5-carbamoyl-1,3-oxazol-2-yl)amino]methanesulfinate?
The IUPAC name of [(5-carbamoyl-1,3-oxazol-2-yl)amino]methanesulfinate (CID 174461737) is [(5-carbamoyl-1,3-oxazol-2-yl)amino]methanesulfinate.
What is the SMILES notation for [(5-carbamoyl-1,3-oxazol-2-yl)amino]methanesulfinate?
The canonical SMILES for [(5-carbamoyl-1,3-oxazol-2-yl)amino]methanesulfinate is NC(=O)c1cnc(NCS(=O)[O-])o1.
What is the InChIKey of [(5-carbamoyl-1,3-oxazol-2-yl)amino]methanesulfinate?
The InChIKey is YPENRQIKFAPTOP-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H7N3O4S/c6-4(9)3-1-7-5(12-3)8-2-13(10)11/h1H,2H2,(H2,6,9)(H,7,8)(H,10,11)/p-1.
What are the key properties of [(5-carbamoyl-1,3-oxazol-2-yl)amino]methanesulfinate?
[(5-carbamoyl-1,3-oxazol-2-yl)amino]methanesulfinate has a molecular weight of 204.19 g/mol, XLogP of -0.98, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(5-carbamoyl-1,3-oxazol-2-yl)amino]methanesulfinate is sourced from PubChem (CID 174461737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).