About 5-prop-2-enyl-1H-imidazol-2-amine;quinoline
5-prop-2-enyl-1H-imidazol-2-amine;quinoline (PubChem CID 174554817) has the molecular formula C15H16N4
and a molecular weight of 252.32 g/mol. Its IUPAC name is 5-prop-2-enyl-1H-imidazol-2-amine;quinoline.
Molecular Properties
| Compound Name | 5-prop-2-enyl-1H-imidazol-2-amine;quinoline |
| PubChem CID | 174554817 |
| Molecular Formula | C15H16N4 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 5-prop-2-enyl-1H-imidazol-2-amine;quinoline |
| SMILES | C=CCc1cnc(N)[nH]1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C6H9N3/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-3-5-4-8-6(7)9-5/h1-7H;2,4H,1,3H2,(H3,7,8,9) |
| InChIKey | HNKDPCDKBGMBLQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-prop-2-enyl-1H-imidazol-2-amine;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-prop-2-enyl-1H-imidazol-2-amine;quinoline?
The IUPAC name of 5-prop-2-enyl-1H-imidazol-2-amine;quinoline (CID 174554817) is 5-prop-2-enyl-1H-imidazol-2-amine;quinoline.
What is the SMILES notation for 5-prop-2-enyl-1H-imidazol-2-amine;quinoline?
The canonical SMILES for 5-prop-2-enyl-1H-imidazol-2-amine;quinoline is C=CCc1cnc(N)[nH]1.c1ccc2ncccc2c1.
What is the InChIKey of 5-prop-2-enyl-1H-imidazol-2-amine;quinoline?
The InChIKey is HNKDPCDKBGMBLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C6H9N3/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-3-5-4-8-6(7)9-5/h1-7H;2,4H,1,3H2,(H3,7,8,9).
What are the key properties of 5-prop-2-enyl-1H-imidazol-2-amine;quinoline?
5-prop-2-enyl-1H-imidazol-2-amine;quinoline has a molecular weight of 252.32 g/mol, XLogP of 2.96, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-prop-2-enyl-1H-imidazol-2-amine;quinoline is sourced from PubChem (CID 174554817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).