About 1,3-benzothiazole;1-bromopentane
1,3-benzothiazole;1-bromopentane (PubChem CID 174559857) has the molecular formula C12H16BrNS
and a molecular weight of 286.24 g/mol. Its IUPAC name is 1,3-benzothiazole;1-bromopentane.
Molecular Properties
| Compound Name | 1,3-benzothiazole;1-bromopentane |
| PubChem CID | 174559857 |
| Molecular Formula | C12H16BrNS |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 1,3-benzothiazole;1-bromopentane |
| SMILES | CCCCCBr.c1ccc2scnc2c1 |
| InChI | InChI=1S/C7H5NS.C5H11Br/c1-2-4-7-6(3-1)8-5-9-7;1-2-3-4-5-6/h1-5H;2-5H2,1H3 |
| InChIKey | UDOZFJUZFDEAFD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,3-benzothiazole;1-bromopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzothiazole;1-bromopentane?
The IUPAC name of 1,3-benzothiazole;1-bromopentane (CID 174559857) is 1,3-benzothiazole;1-bromopentane.
What is the SMILES notation for 1,3-benzothiazole;1-bromopentane?
The canonical SMILES for 1,3-benzothiazole;1-bromopentane is CCCCCBr.c1ccc2scnc2c1.
What is the InChIKey of 1,3-benzothiazole;1-bromopentane?
The InChIKey is UDOZFJUZFDEAFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS.C5H11Br/c1-2-4-7-6(3-1)8-5-9-7;1-2-3-4-5-6/h1-5H;2-5H2,1H3.
What are the key properties of 1,3-benzothiazole;1-bromopentane?
1,3-benzothiazole;1-bromopentane has a molecular weight of 286.24 g/mol, XLogP of 4.87, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazole;1-bromopentane is sourced from PubChem (CID 174559857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).