C25H33N5O6S — CID 174590944
3-(2,4-dihydroxy-5-propan-2-ylphenyl)-2-(2-methylsulfonylethyl)-4-(4-morpholin-4-ylphenyl)-3H-1,2,4-triazole-5-carboxamide (PubChem CID 174590944) has the molecular formula C25H33N5O6S and a molecular weight of 531.64 g/mol. Its IUPAC name is 3-(2,4-dihydroxy-5-propan-2-ylphenyl)-2-(2-methylsulfonylethyl)-4-(4-morpholin-4-ylphenyl)-3H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-(2,4-dihydroxy-5-propan-2-ylphenyl)-2-(2-methylsulfonylethyl)-4-(4-morpholin-4-ylphenyl)-3H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 174590944 |
| Molecular Formula | C25H33N5O6S |
| Molecular Weight | 531.64 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | 3-(2,4-dihydroxy-5-propan-2-ylphenyl)-2-(2-methylsulfonylethyl)-4-(4-morpholin-4-ylphenyl)-3H-1,2,4-triazole-5-carboxamide |
| SMILES | CC(C)c1cc(C2N(CCS(C)(=O)=O)N=C(C(N)=O)N2c2ccc(N3CCOCC3)cc2)c(O)cc1O |
| InChI | InChI=1S/C25H33N5O6S/c1-16(2)19-14-20(22(32)15-21(19)31)25-29(10-13-37(3,34)35)27-24(23(26)33)30(25)18-6-4-17(5-7-18)28-8-11-36-12-9-28/h4-7,14-16,25,31-32H,8-13H2,1-3H3,(H2,26,33) |
| InChIKey | ZIOCMUDXDBAUDX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 149.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.64 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|