About 2-(1-butylimidazol-1-ium-1-yl)ethanol;quinoline;bromide
2-(1-butylimidazol-1-ium-1-yl)ethanol;quinoline;bromide (PubChem CID 174802740) has the molecular formula C18H24BrN3O
and a molecular weight of 378.31 g/mol. Its IUPAC name is 2-(1-butylimidazol-1-ium-1-yl)ethanol;quinoline;bromide.
Molecular Properties
| Compound Name | 2-(1-butylimidazol-1-ium-1-yl)ethanol;quinoline;bromide |
| PubChem CID | 174802740 |
| Molecular Formula | C18H24BrN3O |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 2-(1-butylimidazol-1-ium-1-yl)ethanol;quinoline;bromide |
| SMILES | CCCC[N+]1(CCO)C=CN=C1.[Br-].c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H17N2O.C9H7N.BrH/c1-2-3-5-11(7-8-12)6-4-10-9-11;1-2-6-9-8(4-1)5-3-7-10-9;/h4,6,9,12H,2-3,5,7-8H2,1H3;1-7H;1H/q+1;;/p-1 |
| InChIKey | XWIBQRRGTRDCJY-UHFFFAOYSA-M |
| XLogP | 0.35 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-butylimidazol-1-ium-1-yl)ethanol;quinoline;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-butylimidazol-1-ium-1-yl)ethanol;quinoline;bromide?
The IUPAC name of 2-(1-butylimidazol-1-ium-1-yl)ethanol;quinoline;bromide (CID 174802740) is 2-(1-butylimidazol-1-ium-1-yl)ethanol;quinoline;bromide.
What is the SMILES notation for 2-(1-butylimidazol-1-ium-1-yl)ethanol;quinoline;bromide?
The canonical SMILES for 2-(1-butylimidazol-1-ium-1-yl)ethanol;quinoline;bromide is CCCC[N+]1(CCO)C=CN=C1.[Br-].c1ccc2ncccc2c1.
What is the InChIKey of 2-(1-butylimidazol-1-ium-1-yl)ethanol;quinoline;bromide?
The InChIKey is XWIBQRRGTRDCJY-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H17N2O.C9H7N.BrH/c1-2-3-5-11(7-8-12)6-4-10-9-11;1-2-6-9-8(4-1)5-3-7-10-9;/h4,6,9,12H,2-3,5,7-8H2,1H3;1-7H;1H/q+1;;/p-1.
What are the key properties of 2-(1-butylimidazol-1-ium-1-yl)ethanol;quinoline;bromide?
2-(1-butylimidazol-1-ium-1-yl)ethanol;quinoline;bromide has a molecular weight of 378.31 g/mol, XLogP of 0.35, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-butylimidazol-1-ium-1-yl)ethanol;quinoline;bromide is sourced from PubChem (CID 174802740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).