C25H31F3N2O7S2 — CID 174806025
2-(2-hydroxyethoxy)ethyl 2-[3-(trifluoromethyl)anilino]benzoate;2-[(2-methyl-2-sulfanylpropanoyl)amino]-3-sulfanylpropanoic acid (PubChem CID 174806025) has the molecular formula C25H31F3N2O7S2 and a molecular weight of 592.66 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethyl 2-[3-(trifluoromethyl)anilino]benzoate;2-[(2-methyl-2-sulfanylpropanoyl)amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-(2-hydroxyethoxy)ethyl 2-[3-(trifluoromethyl)anilino]benzoate;2-[(2-methyl-2-sulfanylpropanoyl)amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 174806025 |
| Molecular Formula | C25H31F3N2O7S2 |
| Molecular Weight | 592.66 g/mol |
| Exact Mass | 592.15 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethyl 2-[3-(trifluoromethyl)anilino]benzoate;2-[(2-methyl-2-sulfanylpropanoyl)amino]-3-sulfanylpropanoic acid |
| SMILES | CC(C)(S)C(=O)NC(CS)C(=O)O.O=C(OCCOCCO)c1ccccc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H18F3NO4.C7H13NO3S2/c19-18(20,21)13-4-3-5-14(12-13)22-16-7-2-1-6-15(16)17(24)26-11-10-25-9-8-23;1-7(2,13)6(11)8-4(3-12)5(9)10/h1-7,12,22-23H,8-11H2;4,12-13H,3H2,1-2H3,(H,8,11)(H,9,10) |
| InChIKey | QPCVZYZFXZQBBF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.66 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|