About N-ethylidenehydroxylamine;4-methylbenzenethiol
N-ethylidenehydroxylamine;4-methylbenzenethiol (PubChem CID 174830225) has the molecular formula C9H13NOS
and a molecular weight of 183.28 g/mol. Its IUPAC name is N-ethylidenehydroxylamine;4-methylbenzenethiol.
Molecular Properties
| Compound Name | N-ethylidenehydroxylamine;4-methylbenzenethiol |
| PubChem CID | 174830225 |
| Molecular Formula | C9H13NOS |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | N-ethylidenehydroxylamine;4-methylbenzenethiol |
| SMILES | CC=NO.Cc1ccc(S)cc1 |
| InChI | InChI=1S/C7H8S.C2H5NO/c1-6-2-4-7(8)5-3-6;1-2-3-4/h2-5,8H,1H3;2,4H,1H3 |
| InChIKey | FUIHICSVZNCJGV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-ethylidenehydroxylamine;4-methylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylidenehydroxylamine;4-methylbenzenethiol?
The IUPAC name of N-ethylidenehydroxylamine;4-methylbenzenethiol (CID 174830225) is N-ethylidenehydroxylamine;4-methylbenzenethiol.
What is the SMILES notation for N-ethylidenehydroxylamine;4-methylbenzenethiol?
The canonical SMILES for N-ethylidenehydroxylamine;4-methylbenzenethiol is CC=NO.Cc1ccc(S)cc1.
What is the InChIKey of N-ethylidenehydroxylamine;4-methylbenzenethiol?
The InChIKey is FUIHICSVZNCJGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8S.C2H5NO/c1-6-2-4-7(8)5-3-6;1-2-3-4/h2-5,8H,1H3;2,4H,1H3.
What are the key properties of N-ethylidenehydroxylamine;4-methylbenzenethiol?
N-ethylidenehydroxylamine;4-methylbenzenethiol has a molecular weight of 183.28 g/mol, XLogP of 2.75, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylidenehydroxylamine;4-methylbenzenethiol is sourced from PubChem (CID 174830225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).