C6H17AlO7 — CID 174845924
(2R,3S,4R,5R)-1-alumanylhexane-1,2,3,4,5,6-hexol;hydrate (PubChem CID 174845924) has the molecular formula C6H17AlO7 and a molecular weight of 228.18 g/mol. Its IUPAC name is (2R,3S,4R,5R)-1-alumanylhexane-1,2,3,4,5,6-hexol;hydrate.
| Compound Name | (2R,3S,4R,5R)-1-alumanylhexane-1,2,3,4,5,6-hexol;hydrate |
|---|---|
| PubChem CID | 174845924 |
| Molecular Formula | C6H17AlO7 |
| Molecular Weight | 228.18 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | (2R,3S,4R,5R)-1-alumanylhexane-1,2,3,4,5,6-hexol;hydrate |
| SMILES | O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)[AlH2] |
| InChI | InChI=1S/C6H13O6.Al.H2O.2H/c7-1-3(9)5(11)6(12)4(10)2-8;;;;/h1,3-12H,2H2;;1H2;;/t3-,4+,5+,6+;;;;/m0..../s1 |
| InChIKey | OPXJPSQTRYWSGT-VWFNIEHNSA-N |
| XLogP | -5.45 |
| TPSA | 152.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.18 |
| LogP ≤ 5 | -5.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |