About 3-(2-methylimidazol-1-yl)propan-1-amine;quinoline
3-(2-methylimidazol-1-yl)propan-1-amine;quinoline (PubChem CID 174881981) has the molecular formula C16H20N4
and a molecular weight of 268.36 g/mol. Its IUPAC name is 3-(2-methylimidazol-1-yl)propan-1-amine;quinoline.
Molecular Properties
| Compound Name | 3-(2-methylimidazol-1-yl)propan-1-amine;quinoline |
| PubChem CID | 174881981 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 3-(2-methylimidazol-1-yl)propan-1-amine;quinoline |
| SMILES | Cc1nccn1CCCN.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C7H13N3/c1-2-6-9-8(4-1)5-3-7-10-9;1-7-9-4-6-10(7)5-2-3-8/h1-7H;4,6H,2-3,5,8H2,1H3 |
| InChIKey | DUSMISIISNEFFY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2-methylimidazol-1-yl)propan-1-amine;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methylimidazol-1-yl)propan-1-amine;quinoline?
The IUPAC name of 3-(2-methylimidazol-1-yl)propan-1-amine;quinoline (CID 174881981) is 3-(2-methylimidazol-1-yl)propan-1-amine;quinoline.
What is the SMILES notation for 3-(2-methylimidazol-1-yl)propan-1-amine;quinoline?
The canonical SMILES for 3-(2-methylimidazol-1-yl)propan-1-amine;quinoline is Cc1nccn1CCCN.c1ccc2ncccc2c1.
What is the InChIKey of 3-(2-methylimidazol-1-yl)propan-1-amine;quinoline?
The InChIKey is DUSMISIISNEFFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C7H13N3/c1-2-6-9-8(4-1)5-3-7-10-9;1-7-9-4-6-10(7)5-2-3-8/h1-7H;4,6H,2-3,5,8H2,1H3.
What are the key properties of 3-(2-methylimidazol-1-yl)propan-1-amine;quinoline?
3-(2-methylimidazol-1-yl)propan-1-amine;quinoline has a molecular weight of 268.36 g/mol, XLogP of 2.78, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methylimidazol-1-yl)propan-1-amine;quinoline is sourced from PubChem (CID 174881981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).