C14H16N4 — CID 174882419
1H-benzimidazole;4-methylbenzene-1,2-diamine (PubChem CID 174882419) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is 1H-benzimidazole;4-methylbenzene-1,2-diamine.
| Compound Name | 1H-benzimidazole;4-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 174882419 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 1H-benzimidazole;4-methylbenzene-1,2-diamine |
| SMILES | Cc1ccc(N)c(N)c1.c1ccc2[nH]cnc2c1 |
| InChI | InChI=1S/C7H6N2.C7H10N2/c1-2-4-7-6(3-1)8-5-9-7;1-5-2-3-6(8)7(9)4-5/h1-5H,(H,8,9);2-4H,8-9H2,1H3 |
| InChIKey | QQYMIHZBOQXZLH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|