About butanoyloxy formate;2-methylpropylbenzene
butanoyloxy formate;2-methylpropylbenzene (PubChem CID 174942976) has the molecular formula C15H22O4
and a molecular weight of 266.34 g/mol. Its IUPAC name is butanoyloxy formate;2-methylpropylbenzene.
Molecular Properties
| Compound Name | butanoyloxy formate;2-methylpropylbenzene |
| PubChem CID | 174942976 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | butanoyloxy formate;2-methylpropylbenzene |
| SMILES | CC(C)Cc1ccccc1.CCCC(=O)OOC=O |
| InChI | InChI=1S/C10H14.C5H8O4/c1-9(2)8-10-6-4-3-5-7-10;1-2-3-5(7)9-8-4-6/h3-7,9H,8H2,1-2H3;4H,2-3H2,1H3 |
| InChIKey | SHYVXLPIXNJGLD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze butanoyloxy formate;2-methylpropylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoyloxy formate;2-methylpropylbenzene?
The IUPAC name of butanoyloxy formate;2-methylpropylbenzene (CID 174942976) is butanoyloxy formate;2-methylpropylbenzene.
What is the SMILES notation for butanoyloxy formate;2-methylpropylbenzene?
The canonical SMILES for butanoyloxy formate;2-methylpropylbenzene is CC(C)Cc1ccccc1.CCCC(=O)OOC=O.
What is the InChIKey of butanoyloxy formate;2-methylpropylbenzene?
The InChIKey is SHYVXLPIXNJGLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14.C5H8O4/c1-9(2)8-10-6-4-3-5-7-10;1-2-3-5(7)9-8-4-6/h3-7,9H,8H2,1-2H3;4H,2-3H2,1H3.
What are the key properties of butanoyloxy formate;2-methylpropylbenzene?
butanoyloxy formate;2-methylpropylbenzene has a molecular weight of 266.34 g/mol, XLogP of 3.30, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butanoyloxy formate;2-methylpropylbenzene is sourced from PubChem (CID 174942976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).