C14H14O — CID 174985720
4,4a-dihydro-1H-fluoren-4-ylmethanol (PubChem CID 174985720) has the molecular formula C14H14O and a molecular weight of 198.26 g/mol. Its IUPAC name is 4,4a-dihydro-1H-fluoren-4-ylmethanol.
| Compound Name | 4,4a-dihydro-1H-fluoren-4-ylmethanol |
|---|---|
| PubChem CID | 174985720 |
| Molecular Formula | C14H14O |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 4,4a-dihydro-1H-fluoren-4-ylmethanol |
| SMILES | OCC1C=CCC2=Cc3ccccc3C21 |
| InChI | InChI=1S/C14H14O/c15-9-12-6-3-5-11-8-10-4-1-2-7-13(10)14(11)12/h1-4,6-8,12,14-15H,5,9H2 |
| InChIKey | RTQXJVTULGTFDB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|