About acetic acid;palladium;phenoxybenzene
acetic acid;palladium;phenoxybenzene (PubChem CID 174986322) has the molecular formula C14H13O3Pd-
and a molecular weight of 335.68 g/mol. Its IUPAC name is acetic acid;palladium;phenoxybenzene.
Molecular Properties
| Compound Name | acetic acid;palladium;phenoxybenzene |
| PubChem CID | 174986322 |
| Molecular Formula | C14H13O3Pd- |
| Molecular Weight | 335.68 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | acetic acid;palladium;phenoxybenzene |
| SMILES | CC(=O)O.[Pd].[c-]1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H9O.C2H4O2.Pd/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2(3)4;/h1,3-10H;1H3,(H,3,4);/q-1;; |
| InChIKey | KHUOKDVWLIPNFX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.68 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;palladium;phenoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;palladium;phenoxybenzene?
The IUPAC name of acetic acid;palladium;phenoxybenzene (CID 174986322) is acetic acid;palladium;phenoxybenzene.
What is the SMILES notation for acetic acid;palladium;phenoxybenzene?
The canonical SMILES for acetic acid;palladium;phenoxybenzene is CC(=O)O.[Pd].[c-]1ccc(Oc2ccccc2)cc1.
What is the InChIKey of acetic acid;palladium;phenoxybenzene?
The InChIKey is KHUOKDVWLIPNFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9O.C2H4O2.Pd/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2(3)4;/h1,3-10H;1H3,(H,3,4);/q-1;;.
What are the key properties of acetic acid;palladium;phenoxybenzene?
acetic acid;palladium;phenoxybenzene has a molecular weight of 335.68 g/mol, XLogP of 3.37, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;palladium;phenoxybenzene is sourced from PubChem (CID 174986322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).