C3H7Cl2N3 — CID 175030933
2,3-dichloro-1,1-dimethylguanidine (PubChem CID 175030933) has the molecular formula C3H7Cl2N3 and a molecular weight of 156.02 g/mol. Its IUPAC name is 2,3-dichloro-1,1-dimethylguanidine.
| Compound Name | 2,3-dichloro-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 175030933 |
| Molecular Formula | C3H7Cl2N3 |
| Molecular Weight | 156.02 g/mol |
| Exact Mass | 155.00 |
| IUPAC Name | 2,3-dichloro-1,1-dimethylguanidine |
| SMILES | CN(C)C(=NCl)NCl |
| InChI | InChI=1S/C3H7Cl2N3/c1-8(2)3(6-4)7-5/h1-2H3,(H,6,7) |
| InChIKey | XDKUHXXJEXUODZ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.02 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|