C3H11ClN4O — CID 173362671
2-amino-3-hydroxy-1,1-dimethylguanidine;hydrochloride (PubChem CID 173362671) has the molecular formula C3H11ClN4O and a molecular weight of 154.60 g/mol. Its IUPAC name is 2-amino-3-hydroxy-1,1-dimethylguanidine;hydrochloride.
| Compound Name | 2-amino-3-hydroxy-1,1-dimethylguanidine;hydrochloride |
|---|---|
| PubChem CID | 173362671 |
| Molecular Formula | C3H11ClN4O |
| Molecular Weight | 154.60 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 2-amino-3-hydroxy-1,1-dimethylguanidine;hydrochloride |
| SMILES | CN(C)C(=NN)NO.Cl |
| InChI | InChI=1S/C3H10N4O.ClH/c1-7(2)3(5-4)6-8;/h8H,4H2,1-2H3,(H,5,6);1H |
| InChIKey | NPSCFRRPKGGFFZ-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.60 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|