C15H13Cl2FN2O3 — CID 175109125
N-[(1S)-1-aminoperoxy-2-phenylethyl]-2,4-dichloro-5-fluorobenzamide (PubChem CID 175109125) has the molecular formula C15H13Cl2FN2O3 and a molecular weight of 359.18 g/mol. Its IUPAC name is N-[(1S)-1-aminoperoxy-2-phenylethyl]-2,4-dichloro-5-fluorobenzamide.
| Compound Name | N-[(1S)-1-aminoperoxy-2-phenylethyl]-2,4-dichloro-5-fluorobenzamide |
|---|---|
| PubChem CID | 175109125 |
| Molecular Formula | C15H13Cl2FN2O3 |
| Molecular Weight | 359.18 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | N-[(1S)-1-aminoperoxy-2-phenylethyl]-2,4-dichloro-5-fluorobenzamide |
| SMILES | NOO[C@@H](Cc1ccccc1)NC(=O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H13Cl2FN2O3/c16-11-8-12(17)13(18)7-10(11)15(21)20-14(22-23-19)6-9-4-2-1-3-5-9/h1-5,7-8,14H,6,19H2,(H,20,21)/t14-/m0/s1 |
| InChIKey | WRNVDPGHNKOPSE-AWEZNQCLSA-N |
| XLogP | 3.25 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.18 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|