C18H26N2O5 — CID 175165823
[2-methoxy-5-nitro-4-[[(1S,5S)-3,3,5-trimethylcyclohexyl]amino]phenyl] acetate (PubChem CID 175165823) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is [2-methoxy-5-nitro-4-[[(1S,5S)-3,3,5-trimethylcyclohexyl]amino]phenyl] acetate.
| Compound Name | [2-methoxy-5-nitro-4-[[(1S,5S)-3,3,5-trimethylcyclohexyl]amino]phenyl] acetate |
|---|---|
| PubChem CID | 175165823 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | [2-methoxy-5-nitro-4-[[(1S,5S)-3,3,5-trimethylcyclohexyl]amino]phenyl] acetate |
| SMILES | COc1cc(N[C@H]2C[C@@H](C)CC(C)(C)C2)c([N+](=O)[O-])cc1OC(C)=O |
| InChI | InChI=1S/C18H26N2O5/c1-11-6-13(10-18(3,4)9-11)19-14-7-16(24-5)17(25-12(2)21)8-15(14)20(22)23/h7-8,11,13,19H,6,9-10H2,1-5H3/t11-,13+/m1/s1 |
| InChIKey | BOPNUQFEBPQBQE-YPMHNXCESA-N |
| XLogP | 4.16 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|