About potassium;N-methanidyl-N-methyl-1-phenylmethanamine;trifluoroborane
potassium;N-methanidyl-N-methyl-1-phenylmethanamine;trifluoroborane (PubChem CID 175179431) has the molecular formula C9H12BF3KN
and a molecular weight of 241.11 g/mol. Its IUPAC name is potassium;N-methanidyl-N-methyl-1-phenylmethanamine;trifluoroborane.
Molecular Properties
| Compound Name | potassium;N-methanidyl-N-methyl-1-phenylmethanamine;trifluoroborane |
| PubChem CID | 175179431 |
| Molecular Formula | C9H12BF3KN |
| Molecular Weight | 241.11 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | potassium;N-methanidyl-N-methyl-1-phenylmethanamine;trifluoroborane |
| SMILES | FB(F)F.[CH2-]N(C)Cc1ccccc1.[K+] |
| InChI | InChI=1S/C9H12N.BF3.K/c1-10(2)8-9-6-4-3-5-7-9;2-1(3)4;/h3-7H,1,8H2,2H3;;/q-1;;+1 |
| InChIKey | RHXUQAVIYJJGSC-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.11 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze potassium;N-methanidyl-N-methyl-1-phenylmethanamine;trifluoroborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;N-methanidyl-N-methyl-1-phenylmethanamine;trifluoroborane?
The IUPAC name of potassium;N-methanidyl-N-methyl-1-phenylmethanamine;trifluoroborane (CID 175179431) is potassium;N-methanidyl-N-methyl-1-phenylmethanamine;trifluoroborane.
What is the SMILES notation for potassium;N-methanidyl-N-methyl-1-phenylmethanamine;trifluoroborane?
The canonical SMILES for potassium;N-methanidyl-N-methyl-1-phenylmethanamine;trifluoroborane is FB(F)F.[CH2-]N(C)Cc1ccccc1.[K+].
What is the InChIKey of potassium;N-methanidyl-N-methyl-1-phenylmethanamine;trifluoroborane?
The InChIKey is RHXUQAVIYJJGSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N.BF3.K/c1-10(2)8-9-6-4-3-5-7-9;2-1(3)4;/h3-7H,1,8H2,2H3;;/q-1;;+1.
What are the key properties of potassium;N-methanidyl-N-methyl-1-phenylmethanamine;trifluoroborane?
potassium;N-methanidyl-N-methyl-1-phenylmethanamine;trifluoroborane has a molecular weight of 241.11 g/mol, XLogP of -0.21, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;N-methanidyl-N-methyl-1-phenylmethanamine;trifluoroborane is sourced from PubChem (CID 175179431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).